C14H17Cl2N3O2S — CID 8689243
4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]butanenitrile (PubChem CID 8689243) has the molecular formula C14H17Cl2N3O2S and a molecular weight of 362.28 g/mol. Its IUPAC name is 4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]butanenitrile.
| Compound Name | 4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 8689243 |
| Molecular Formula | C14H17Cl2N3O2S |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]butanenitrile |
| SMILES | N#CCCCN1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C14H17Cl2N3O2S/c15-12-3-4-13(16)14(11-12)22(20,21)19-9-7-18(8-10-19)6-2-1-5-17/h3-4,11H,1-2,6-10H2 |
| InChIKey | FSIGVXQBPIMHLV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|