C25H28N4O5S — CID 24515155
4-(4-benzylpiperazin-1-yl)sulfonyl-N'-[3-(furan-2-yl)propanoyl]benzohydrazide (PubChem CID 24515155) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)sulfonyl-N'-[3-(furan-2-yl)propanoyl]benzohydrazide.
| Compound Name | 4-(4-benzylpiperazin-1-yl)sulfonyl-N'-[3-(furan-2-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 24515155 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)sulfonyl-N'-[3-(furan-2-yl)propanoyl]benzohydrazide |
| SMILES | O=C(CCc1ccco1)NNC(=O)c1ccc(S(=O)(=O)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H28N4O5S/c30-24(13-10-22-7-4-18-34-22)26-27-25(31)21-8-11-23(12-9-21)35(32,33)29-16-14-28(15-17-29)19-20-5-2-1-3-6-20/h1-9,11-12,18H,10,13-17,19H2,(H,26,30)(H,27,31) |
| InChIKey | JQBWXPOPYZPDJZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|