C14H18FN3O3S2 — CID 18133827
3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-oxazolidine-2-thione (PubChem CID 18133827) has the molecular formula C14H18FN3O3S2 and a molecular weight of 359.45 g/mol. Its IUPAC name is 3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-oxazolidine-2-thione.
| Compound Name | 3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 18133827 |
| Molecular Formula | C14H18FN3O3S2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-oxazolidine-2-thione |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CCN(CN2CCOC2=S)CC1 |
| InChI | InChI=1S/C14H18FN3O3S2/c15-12-2-1-3-13(10-12)23(19,20)18-6-4-16(5-7-18)11-17-8-9-21-14(17)22/h1-3,10H,4-9,11H2 |
| InChIKey | OSCAJKQEMHVNDK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|