C17H17FN4O3S3 — CID 27079253
3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione (PubChem CID 27079253) has the molecular formula C17H17FN4O3S3 and a molecular weight of 440.55 g/mol. Its IUPAC name is 3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 27079253 |
| Molecular Formula | C17H17FN4O3S3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CCN(Cn2nc(-c3cccs3)oc2=S)CC1 |
| InChI | InChI=1S/C17H17FN4O3S3/c18-13-3-1-4-14(11-13)28(23,24)21-8-6-20(7-9-21)12-22-17(26)25-16(19-22)15-5-2-10-27-15/h1-5,10-11H,6-9,12H2 |
| InChIKey | CTXVZXHLEIOHDC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|