C18H19ClN4OS2 — CID 30726446
3-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione (PubChem CID 30726446) has the molecular formula C18H19ClN4OS2 and a molecular weight of 406.96 g/mol. Its IUPAC name is 3-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 30726446 |
| Molecular Formula | C18H19ClN4OS2 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 3-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(-c2cccs2)nn1CN1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H19ClN4OS2/c19-15-5-3-14(4-6-15)12-21-7-9-22(10-8-21)13-23-18(25)24-17(20-23)16-2-1-11-26-16/h1-6,11H,7-10,12-13H2 |
| InChIKey | IICMAZBOZIVPOU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|