C15H16N4O4S3 — CID 4858544
5-(furan-2-yl)-3-[(4-thiophen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 4858544) has the molecular formula C15H16N4O4S3 and a molecular weight of 412.52 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-[(4-thiophen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(furan-2-yl)-3-[(4-thiophen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 4858544 |
| Molecular Formula | C15H16N4O4S3 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 5-(furan-2-yl)-3-[(4-thiophen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | O=S(=O)(c1cccs1)N1CCN(Cn2nc(-c3ccco3)oc2=S)CC1 |
| InChI | InChI=1S/C15H16N4O4S3/c20-26(21,13-4-2-10-25-13)18-7-5-17(6-8-18)11-19-15(24)23-14(16-19)12-3-1-9-22-12/h1-4,9-10H,5-8,11H2 |
| InChIKey | LHDKYSKKTDQWFB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|