C18H26N6O3S2 — CID 121053278
2-[4-[6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanol (PubChem CID 121053278) has the molecular formula C18H26N6O3S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 2-[4-[6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 121053278 |
| Molecular Formula | C18H26N6O3S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[4-[6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanol |
| SMILES | O=S(=O)(c1cccs1)N1CCN(c2ccc(N3CCN(CCO)CC3)nn2)CC1 |
| InChI | InChI=1S/C18H26N6O3S2/c25-14-13-21-5-7-22(8-6-21)16-3-4-17(20-19-16)23-9-11-24(12-10-23)29(26,27)18-2-1-15-28-18/h1-4,15,25H,5-14H2 |
| InChIKey | LMVAZHNKHBVQSK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |