C18H31N7O3S — CID 122336864
2-[4-[6-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanol (PubChem CID 122336864) has the molecular formula C18H31N7O3S and a molecular weight of 425.56 g/mol. Its IUPAC name is 2-[4-[6-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[6-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 122336864 |
| Molecular Formula | C18H31N7O3S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-[4-[6-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanol |
| SMILES | O=S(=O)(N1CCCC1)N1CCN(c2ccc(N3CCN(CCO)CC3)nn2)CC1 |
| InChI | InChI=1S/C18H31N7O3S/c26-16-15-21-7-9-22(10-8-21)17-3-4-18(20-19-17)23-11-13-25(14-12-23)29(27,28)24-5-1-2-6-24/h3-4,26H,1-2,5-16H2 |
| InChIKey | AJGCHWLFKJLNMX-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |