C16H28N6O2S — CID 121038125
3-(4-ethylpiperazin-1-yl)-6-(4-ethylsulfonylpiperazin-1-yl)pyridazine (PubChem CID 121038125) has the molecular formula C16H28N6O2S and a molecular weight of 368.51 g/mol. Its IUPAC name is 3-(4-ethylpiperazin-1-yl)-6-(4-ethylsulfonylpiperazin-1-yl)pyridazine.
| Compound Name | 3-(4-ethylpiperazin-1-yl)-6-(4-ethylsulfonylpiperazin-1-yl)pyridazine |
|---|---|
| PubChem CID | 121038125 |
| Molecular Formula | C16H28N6O2S |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 3-(4-ethylpiperazin-1-yl)-6-(4-ethylsulfonylpiperazin-1-yl)pyridazine |
| SMILES | CCN1CCN(c2ccc(N3CCN(S(=O)(=O)CC)CC3)nn2)CC1 |
| InChI | InChI=1S/C16H28N6O2S/c1-3-19-7-9-20(10-8-19)15-5-6-16(18-17-15)21-11-13-22(14-12-21)25(23,24)4-2/h5-6H,3-4,7-14H2,1-2H3 |
| InChIKey | HNCGZTXINPJIAZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |