C18H31N5O2S — CID 121053116
1-[6-(4-butylsulfonylpiperazin-1-yl)pyridazin-3-yl]azepane (PubChem CID 121053116) has the molecular formula C18H31N5O2S and a molecular weight of 381.55 g/mol. Its IUPAC name is 1-[6-(4-butylsulfonylpiperazin-1-yl)pyridazin-3-yl]azepane.
| Compound Name | 1-[6-(4-butylsulfonylpiperazin-1-yl)pyridazin-3-yl]azepane |
|---|---|
| PubChem CID | 121053116 |
| Molecular Formula | C18H31N5O2S |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1-[6-(4-butylsulfonylpiperazin-1-yl)pyridazin-3-yl]azepane |
| SMILES | CCCCS(=O)(=O)N1CCN(c2ccc(N3CCCCCC3)nn2)CC1 |
| InChI | InChI=1S/C18H31N5O2S/c1-2-3-16-26(24,25)23-14-12-22(13-15-23)18-9-8-17(19-20-18)21-10-6-4-5-7-11-21/h8-9H,2-7,10-16H2,1H3 |
| InChIKey | ICYDTLUHEIJTFC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |