C16H22N4O2S2 — CID 121058587
3-(4-butylsulfonylpiperazin-1-yl)-6-thiophen-2-ylpyridazine (PubChem CID 121058587) has the molecular formula C16H22N4O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-(4-butylsulfonylpiperazin-1-yl)-6-thiophen-2-ylpyridazine.
| Compound Name | 3-(4-butylsulfonylpiperazin-1-yl)-6-thiophen-2-ylpyridazine |
|---|---|
| PubChem CID | 121058587 |
| Molecular Formula | C16H22N4O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-(4-butylsulfonylpiperazin-1-yl)-6-thiophen-2-ylpyridazine |
| SMILES | CCCCS(=O)(=O)N1CCN(c2ccc(-c3cccs3)nn2)CC1 |
| InChI | InChI=1S/C16H22N4O2S2/c1-2-3-13-24(21,22)20-10-8-19(9-11-20)16-7-6-14(17-18-16)15-5-4-12-23-15/h4-7,12H,2-3,8-11,13H2,1H3 |
| InChIKey | DUNOFKWGERVGSI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |