C20H19BrN4OS — CID 41233311
2-(4-bromophenyl)-1-[4-(6-thiophen-2-ylpyridazin-3-yl)piperazin-1-yl]ethanone (PubChem CID 41233311) has the molecular formula C20H19BrN4OS and a molecular weight of 443.37 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-[4-(6-thiophen-2-ylpyridazin-3-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-bromophenyl)-1-[4-(6-thiophen-2-ylpyridazin-3-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 41233311 |
| Molecular Formula | C20H19BrN4OS |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 2-(4-bromophenyl)-1-[4-(6-thiophen-2-ylpyridazin-3-yl)piperazin-1-yl]ethanone |
| SMILES | O=C(Cc1ccc(Br)cc1)N1CCN(c2ccc(-c3cccs3)nn2)CC1 |
| InChI | InChI=1S/C20H19BrN4OS/c21-16-5-3-15(4-6-16)14-20(26)25-11-9-24(10-12-25)19-8-7-17(22-23-19)18-2-1-13-27-18/h1-8,13H,9-12,14H2 |
| InChIKey | HGVYWCQPTHHGRW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |