C23H33N5OS — CID 20947299
(4-pentan-2-ylpiperazin-1-yl)-[1-(6-thiophen-2-ylpyridazin-3-yl)piperidin-4-yl]methanone (PubChem CID 20947299) has the molecular formula C23H33N5OS and a molecular weight of 427.62 g/mol. Its IUPAC name is (4-pentan-2-ylpiperazin-1-yl)-[1-(6-thiophen-2-ylpyridazin-3-yl)piperidin-4-yl]methanone.
| Compound Name | (4-pentan-2-ylpiperazin-1-yl)-[1-(6-thiophen-2-ylpyridazin-3-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 20947299 |
| Molecular Formula | C23H33N5OS |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | (4-pentan-2-ylpiperazin-1-yl)-[1-(6-thiophen-2-ylpyridazin-3-yl)piperidin-4-yl]methanone |
| SMILES | CCCC(C)N1CCN(C(=O)C2CCN(c3ccc(-c4cccs4)nn3)CC2)CC1 |
| InChI | InChI=1S/C23H33N5OS/c1-3-5-18(2)26-13-15-28(16-14-26)23(29)19-9-11-27(12-10-19)22-8-7-20(24-25-22)21-6-4-17-30-21/h4,6-8,17-19H,3,5,9-16H2,1-2H3 |
| InChIKey | QDXSDAYPYGBRJB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |