C24H26N4OS — CID 20947300
(3-phenylpyrrolidin-1-yl)-[1-(6-thiophen-2-ylpyridazin-3-yl)piperidin-4-yl]methanone (PubChem CID 20947300) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is (3-phenylpyrrolidin-1-yl)-[1-(6-thiophen-2-ylpyridazin-3-yl)piperidin-4-yl]methanone.
| Compound Name | (3-phenylpyrrolidin-1-yl)-[1-(6-thiophen-2-ylpyridazin-3-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 20947300 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (3-phenylpyrrolidin-1-yl)-[1-(6-thiophen-2-ylpyridazin-3-yl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ccc(-c3cccs3)nn2)CC1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C24H26N4OS/c29-24(28-15-12-20(17-28)18-5-2-1-3-6-18)19-10-13-27(14-11-19)23-9-8-21(25-26-23)22-7-4-16-30-22/h1-9,16,19-20H,10-15,17H2 |
| InChIKey | VFWCOLJQUJRAAG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |