C19H32N6O — CID 121038195
1-[4-[6-(4-ethylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]-3-methylbutan-1-one (PubChem CID 121038195) has the molecular formula C19H32N6O and a molecular weight of 360.51 g/mol. Its IUPAC name is 1-[4-[6-(4-ethylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[4-[6-(4-ethylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 121038195 |
| Molecular Formula | C19H32N6O |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 1-[4-[6-(4-ethylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]-3-methylbutan-1-one |
| SMILES | CCN1CCN(c2ccc(N3CCN(C(=O)CC(C)C)CC3)nn2)CC1 |
| InChI | InChI=1S/C19H32N6O/c1-4-22-7-9-23(10-8-22)17-5-6-18(21-20-17)24-11-13-25(14-12-24)19(26)15-16(2)3/h5-6,16H,4,7-15H2,1-3H3 |
| InChIKey | RENGHMNXTLPVFH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |