C17H24N6O — CID 121113750
3-methyl-1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]butan-1-one (PubChem CID 121113750) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-methyl-1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]butan-1-one.
| Compound Name | 3-methyl-1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 121113750 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 3-methyl-1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]butan-1-one |
| SMILES | Cc1nccn1-c1ccc(N2CCN(C(=O)CC(C)C)CC2)nn1 |
| InChI | InChI=1S/C17H24N6O/c1-13(2)12-17(24)22-10-8-21(9-11-22)15-4-5-16(20-19-15)23-7-6-18-14(23)3/h4-7,13H,8-12H2,1-3H3 |
| InChIKey | NZEYPKNWXLPJKS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |