C19H21N7O2 — CID 121113859
1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-2-pyridin-3-yloxyethanone (PubChem CID 121113859) has the molecular formula C19H21N7O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-2-pyridin-3-yloxyethanone.
| Compound Name | 1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-2-pyridin-3-yloxyethanone |
|---|---|
| PubChem CID | 121113859 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-2-pyridin-3-yloxyethanone |
| SMILES | Cc1nccn1-c1ccc(N2CCN(C(=O)COc3cccnc3)CC2)nn1 |
| InChI | InChI=1S/C19H21N7O2/c1-15-21-7-8-26(15)18-5-4-17(22-23-18)24-9-11-25(12-10-24)19(27)14-28-16-3-2-6-20-13-16/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | OHRCMRCHYUXCKM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |