C21H28N8O6S — CID 121038128
3-(4-ethylpiperazin-1-yl)-6-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]pyridazine (PubChem CID 121038128) has the molecular formula C21H28N8O6S and a molecular weight of 520.57 g/mol. Its IUPAC name is 3-(4-ethylpiperazin-1-yl)-6-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]pyridazine.
| Compound Name | 3-(4-ethylpiperazin-1-yl)-6-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 121038128 |
| Molecular Formula | C21H28N8O6S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 3-(4-ethylpiperazin-1-yl)-6-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]pyridazine |
| SMILES | CCN1CCN(c2ccc(N3CCN(S(=O)(=O)c4cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c4)CC3)nn2)CC1 |
| InChI | InChI=1S/C21H28N8O6S/c1-3-24-6-8-25(9-7-24)20-4-5-21(23-22-20)26-10-12-27(13-11-26)36(34,35)17-14-18(28(30)31)16(2)19(15-17)29(32)33/h4-5,14-15H,3,6-13H2,1-2H3 |
| InChIKey | AVQZNESQDUFEPE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 159.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|