C12H18N4O4S — CID 26455707
4-(4-ethylpiperazin-1-yl)-3-nitrobenzenesulfonamide (PubChem CID 26455707) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 26455707 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-3-nitrobenzenesulfonamide |
| SMILES | CCN1CCN(c2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H18N4O4S/c1-2-14-5-7-15(8-6-14)11-4-3-10(21(13,19)20)9-12(11)16(17)18/h3-4,9H,2,5-8H2,1H3,(H2,13,19,20) |
| InChIKey | NLNCXHDPUORETP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|