C14H20N4O5S — CID 55828579
N-[[1-(2-nitro-4-sulfamoylphenyl)piperidin-4-yl]methyl]acetamide (PubChem CID 55828579) has the molecular formula C14H20N4O5S and a molecular weight of 356.40 g/mol. Its IUPAC name is N-[[1-(2-nitro-4-sulfamoylphenyl)piperidin-4-yl]methyl]acetamide.
| Compound Name | N-[[1-(2-nitro-4-sulfamoylphenyl)piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 55828579 |
| Molecular Formula | C14H20N4O5S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[[1-(2-nitro-4-sulfamoylphenyl)piperidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCN(c2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H20N4O5S/c1-10(19)16-9-11-4-6-17(7-5-11)13-3-2-12(24(15,22)23)8-14(13)18(20)21/h2-3,8,11H,4-7,9H2,1H3,(H,16,19)(H2,15,22,23) |
| InChIKey | CHVNCCGTQWEDBK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|