C15H22N4O5S — CID 55828149
2-methyl-N-[1-(2-nitro-4-sulfamoylphenyl)piperidin-4-yl]propanamide (PubChem CID 55828149) has the molecular formula C15H22N4O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-methyl-N-[1-(2-nitro-4-sulfamoylphenyl)piperidin-4-yl]propanamide.
| Compound Name | 2-methyl-N-[1-(2-nitro-4-sulfamoylphenyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 55828149 |
| Molecular Formula | C15H22N4O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-methyl-N-[1-(2-nitro-4-sulfamoylphenyl)piperidin-4-yl]propanamide |
| SMILES | CC(C)C(=O)NC1CCN(c2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H22N4O5S/c1-10(2)15(20)17-11-5-7-18(8-6-11)13-4-3-12(25(16,23)24)9-14(13)19(21)22/h3-4,9-11H,5-8H2,1-2H3,(H,17,20)(H2,16,23,24) |
| InChIKey | FFXJTZNWHHBYQA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|