C20H29N5O6S — CID 24587949
N-cyclopropyl-2-[4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperazin-1-yl]propanamide (PubChem CID 24587949) has the molecular formula C20H29N5O6S and a molecular weight of 467.55 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperazin-1-yl]propanamide.
| Compound Name | N-cyclopropyl-2-[4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 24587949 |
| Molecular Formula | C20H29N5O6S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-cyclopropyl-2-[4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)NC1CC1)N1CCN(c2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H29N5O6S/c1-15(20(26)21-16-2-3-16)22-6-8-23(9-7-22)18-5-4-17(14-19(18)25(27)28)32(29,30)24-10-12-31-13-11-24/h4-5,14-16H,2-3,6-13H2,1H3,(H,21,26) |
| InChIKey | TXERLPBOCIGQML-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|