C21H32N4O6S — CID 24639365
1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)-N-pentan-2-ylpiperidine-4-carboxamide (PubChem CID 24639365) has the molecular formula C21H32N4O6S and a molecular weight of 468.58 g/mol. Its IUPAC name is 1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)-N-pentan-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)-N-pentan-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24639365 |
| Molecular Formula | C21H32N4O6S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)-N-pentan-2-ylpiperidine-4-carboxamide |
| SMILES | CCCC(C)NC(=O)C1CCN(c2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H32N4O6S/c1-3-4-16(2)22-21(26)17-7-9-23(10-8-17)19-6-5-18(15-20(19)25(27)28)32(29,30)24-11-13-31-14-12-24/h5-6,15-17H,3-4,7-14H2,1-2H3,(H,22,26) |
| InChIKey | BGZUZYXFJVPCND-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|