C19H28ClN3O4S — CID 3227693
1-(2-chloro-4-morpholin-4-ylsulfonylphenyl)-N-propylpiperidine-4-carboxamide (PubChem CID 3227693) has the molecular formula C19H28ClN3O4S and a molecular weight of 429.97 g/mol. Its IUPAC name is 1-(2-chloro-4-morpholin-4-ylsulfonylphenyl)-N-propylpiperidine-4-carboxamide.
| Compound Name | 1-(2-chloro-4-morpholin-4-ylsulfonylphenyl)-N-propylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3227693 |
| Molecular Formula | C19H28ClN3O4S |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 1-(2-chloro-4-morpholin-4-ylsulfonylphenyl)-N-propylpiperidine-4-carboxamide |
| SMILES | CCCNC(=O)C1CCN(c2ccc(S(=O)(=O)N3CCOCC3)cc2Cl)CC1 |
| InChI | InChI=1S/C19H28ClN3O4S/c1-2-7-21-19(24)15-5-8-22(9-6-15)18-4-3-16(14-17(18)20)28(25,26)23-10-12-27-13-11-23/h3-4,14-15H,2,5-13H2,1H3,(H,21,24) |
| InChIKey | MGIAWSBQMSLHQK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |