C19H29N5O5S — CID 30869113
N-ethyl-1-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]piperidine-4-carboxamide (PubChem CID 30869113) has the molecular formula C19H29N5O5S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-ethyl-1-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]piperidine-4-carboxamide.
| Compound Name | N-ethyl-1-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30869113 |
| Molecular Formula | C19H29N5O5S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-ethyl-1-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]piperidine-4-carboxamide |
| SMILES | CCNC(=O)C1CCN(c2ccc(S(=O)(=O)N3CCN(C)CC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H29N5O5S/c1-3-20-19(25)15-6-8-22(9-7-15)17-5-4-16(14-18(17)24(26)27)30(28,29)23-12-10-21(2)11-13-23/h4-5,14-15H,3,6-13H2,1-2H3,(H,20,25) |
| InChIKey | DNTLEHJRMGNCFH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|