C20H28N6O4S — CID 133280068
1-methyl-4-[4-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-3-nitrophenyl]sulfonylpiperazine (PubChem CID 133280068) has the molecular formula C20H28N6O4S and a molecular weight of 448.55 g/mol. Its IUPAC name is 1-methyl-4-[4-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-3-nitrophenyl]sulfonylpiperazine.
| Compound Name | 1-methyl-4-[4-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-3-nitrophenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 133280068 |
| Molecular Formula | C20H28N6O4S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 1-methyl-4-[4-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-3-nitrophenyl]sulfonylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(N3CCC(c4ccnn4C)CC3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C20H28N6O4S/c1-22-11-13-25(14-12-22)31(29,30)17-3-4-19(20(15-17)26(27)28)24-9-6-16(7-10-24)18-5-8-21-23(18)2/h3-5,8,15-16H,6-7,9-14H2,1-2H3 |
| InChIKey | ZJOFAHHRAHOQBE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 104.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|