C17H26N4O6S2 — CID 24632022
1-methylsulfonyl-4-(2-nitro-4-piperidin-1-ylsulfonylphenyl)-1,4-diazepane (PubChem CID 24632022) has the molecular formula C17H26N4O6S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is 1-methylsulfonyl-4-(2-nitro-4-piperidin-1-ylsulfonylphenyl)-1,4-diazepane.
| Compound Name | 1-methylsulfonyl-4-(2-nitro-4-piperidin-1-ylsulfonylphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 24632022 |
| Molecular Formula | C17H26N4O6S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 1-methylsulfonyl-4-(2-nitro-4-piperidin-1-ylsulfonylphenyl)-1,4-diazepane |
| SMILES | CS(=O)(=O)N1CCCN(c2ccc(S(=O)(=O)N3CCCCC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H26N4O6S2/c1-28(24,25)19-11-5-8-18(12-13-19)16-7-6-15(14-17(16)21(22)23)29(26,27)20-9-3-2-4-10-20/h6-7,14H,2-5,8-13H2,1H3 |
| InChIKey | VDFBKJAZSBOQKK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|