C17H25N3O5S — CID 18074908
1-[4-(azepan-1-ylsulfonyl)-2-nitrophenyl]piperidin-3-ol (PubChem CID 18074908) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is 1-[4-(azepan-1-ylsulfonyl)-2-nitrophenyl]piperidin-3-ol.
| Compound Name | 1-[4-(azepan-1-ylsulfonyl)-2-nitrophenyl]piperidin-3-ol |
|---|---|
| PubChem CID | 18074908 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-[4-(azepan-1-ylsulfonyl)-2-nitrophenyl]piperidin-3-ol |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCCC2)ccc1N1CCCC(O)C1 |
| InChI | InChI=1S/C17H25N3O5S/c21-14-6-5-9-18(13-14)16-8-7-15(12-17(16)20(22)23)26(24,25)19-10-3-1-2-4-11-19/h7-8,12,14,21H,1-6,9-11,13H2 |
| InChIKey | UFOMUNWLTRJZNN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|