C15H21N3O5S — CID 75455060
[1-(2-nitro-4-piperidin-1-ylsulfonylphenyl)azetidin-3-yl]methanol (PubChem CID 75455060) has the molecular formula C15H21N3O5S and a molecular weight of 355.42 g/mol. Its IUPAC name is [1-(2-nitro-4-piperidin-1-ylsulfonylphenyl)azetidin-3-yl]methanol.
| Compound Name | [1-(2-nitro-4-piperidin-1-ylsulfonylphenyl)azetidin-3-yl]methanol |
|---|---|
| PubChem CID | 75455060 |
| Molecular Formula | C15H21N3O5S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [1-(2-nitro-4-piperidin-1-ylsulfonylphenyl)azetidin-3-yl]methanol |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1N1CC(CO)C1 |
| InChI | InChI=1S/C15H21N3O5S/c19-11-12-9-16(10-12)14-5-4-13(8-15(14)18(20)21)24(22,23)17-6-2-1-3-7-17/h4-5,8,12,19H,1-3,6-7,9-11H2 |
| InChIKey | NEHGKPXCPWNEJU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|