C22H26N4O6S — CID 26249655
N-(3-morpholin-4-ylsulfonylphenyl)-1-(2-nitrophenyl)piperidine-4-carboxamide (PubChem CID 26249655) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is N-(3-morpholin-4-ylsulfonylphenyl)-1-(2-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | N-(3-morpholin-4-ylsulfonylphenyl)-1-(2-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26249655 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N-(3-morpholin-4-ylsulfonylphenyl)-1-(2-nitrophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCOCC2)c1)C1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H26N4O6S/c27-22(17-8-10-24(11-9-17)20-6-1-2-7-21(20)26(28)29)23-18-4-3-5-19(16-18)33(30,31)25-12-14-32-15-13-25/h1-7,16-17H,8-15H2,(H,23,27) |
| InChIKey | AJTZRBMDNCFPFX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|