C25H26FN5O6S2 — CID 3563978
N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidine-4-carboxamide (PubChem CID 3563978) has the molecular formula C25H26FN5O6S2 and a molecular weight of 575.64 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3563978 |
| Molecular Formula | C25H26FN5O6S2 |
| Molecular Weight | 575.64 g/mol |
| Exact Mass | 575.13 |
| IUPAC Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2)cs1)C1CCN(c2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C25H26FN5O6S2/c26-19-3-1-17(2-4-19)21-16-38-25(27-21)28-24(32)18-7-9-29(10-8-18)22-6-5-20(15-23(22)31(33)34)39(35,36)30-11-13-37-14-12-30/h1-6,15-16,18H,7-14H2,(H,27,28,32) |
| InChIKey | WMXPSHWITZSWMU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 134.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|