C22H19FN4O6S — CID 23849526
[2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate (PubChem CID 23849526) has the molecular formula C22H19FN4O6S and a molecular weight of 486.48 g/mol. Its IUPAC name is [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate.
| Compound Name | [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 23849526 |
| Molecular Formula | C22H19FN4O6S |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C22H19FN4O6S/c23-16-4-1-14(2-5-16)17-13-34-22(24-17)25-20(28)12-33-21(29)15-3-6-18(19(11-15)27(30)31)26-7-9-32-10-8-26/h1-6,11,13H,7-10,12H2,(H,24,25,28) |
| InChIKey | MODGTQDSQPXWKI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|