C22H19N5O10S2 — CID 23740453
[2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate (PubChem CID 23740453) has the molecular formula C22H19N5O10S2 and a molecular weight of 577.55 g/mol. Its IUPAC name is [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate.
| Compound Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 23740453 |
| Molecular Formula | C22H19N5O10S2 |
| Molecular Weight | 577.55 g/mol |
| Exact Mass | 577.06 |
| IUPAC Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C22H19N5O10S2/c28-19(24-22-23-12-20(38-22)39(34,35)16-4-2-15(3-5-16)26(30)31)13-37-21(29)14-1-6-17(18(11-14)27(32)33)25-7-9-36-10-8-25/h1-6,11-12H,7-10,13H2,(H,23,24,28) |
| InChIKey | XSMNVSRXFHYMJZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 201.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|