C18H14N4O7S2 — CID 23822134
[2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-aminobenzoate (PubChem CID 23822134) has the molecular formula C18H14N4O7S2 and a molecular weight of 462.47 g/mol. Its IUPAC name is [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-aminobenzoate.
| Compound Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 23822134 |
| Molecular Formula | C18H14N4O7S2 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)OCC(=O)Nc2ncc(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)s2)cc1 |
| InChI | InChI=1S/C18H14N4O7S2/c19-12-3-1-11(2-4-12)17(24)29-10-15(23)21-18-20-9-16(30-18)31(27,28)14-7-5-13(6-8-14)22(25)26/h1-9H,10,19H2,(H,20,21,23) |
| InChIKey | IYHFHGPOYJCHPS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 171.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|