C20H17N3O8S2 — CID 26251785
2-(4-acetyl-2-methoxyphenoxy)-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide (PubChem CID 26251785) has the molecular formula C20H17N3O8S2 and a molecular weight of 491.50 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 26251785 |
| Molecular Formula | C20H17N3O8S2 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C20H17N3O8S2/c1-12(24)13-3-8-16(17(9-13)30-2)31-11-18(25)22-20-21-10-19(32-20)33(28,29)15-6-4-14(5-7-15)23(26)27/h3-10H,11H2,1-2H3,(H,21,22,25) |
| InChIKey | PTXUBHQQPKTFMJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 154.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|