C25H19FN4O9S3 — CID 25037366
[2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate (PubChem CID 25037366) has the molecular formula C25H19FN4O9S3 and a molecular weight of 634.65 g/mol. Its IUPAC name is [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate.
| Compound Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 25037366 |
| Molecular Formula | C25H19FN4O9S3 |
| Molecular Weight | 634.65 g/mol |
| Exact Mass | 634.03 |
| IUPAC Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)Nc1ccc(C(=O)OCC(=O)Nc2ncc(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)s2)cc1 |
| InChI | InChI=1S/C25H19FN4O9S3/c1-15-12-17(26)4-11-21(15)42(37,38)29-18-5-2-16(3-6-18)24(32)39-14-22(31)28-25-27-13-23(40-25)41(35,36)20-9-7-19(8-10-20)30(33)34/h2-13,29H,14H2,1H3,(H,27,28,31) |
| InChIKey | RMAANWCNXXYYTK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 191.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|