C19H14FN3O7S2 — CID 23741863
[2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(4-fluorophenyl)acetate (PubChem CID 23741863) has the molecular formula C19H14FN3O7S2 and a molecular weight of 479.47 g/mol. Its IUPAC name is [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(4-fluorophenyl)acetate.
| Compound Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 23741863 |
| Molecular Formula | C19H14FN3O7S2 |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(4-fluorophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc(F)cc1)Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C19H14FN3O7S2/c20-13-3-1-12(2-4-13)9-17(25)30-11-16(24)22-19-21-10-18(31-19)32(28,29)15-7-5-14(6-8-15)23(26)27/h1-8,10H,9,11H2,(H,21,22,24) |
| InChIKey | ORDJEISADMOONA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|