C20H18N4O9S3 — CID 23936280
[2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-(dimethylsulfamoyl)benzoate (PubChem CID 23936280) has the molecular formula C20H18N4O9S3 and a molecular weight of 554.58 g/mol. Its IUPAC name is [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 23936280 |
| Molecular Formula | C20H18N4O9S3 |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.02 |
| IUPAC Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2ncc(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)s2)cc1 |
| InChI | InChI=1S/C20H18N4O9S3/c1-23(2)36(31,32)16-7-3-13(4-8-16)19(26)33-12-17(25)22-20-21-11-18(34-20)35(29,30)15-9-5-14(6-10-15)24(27)28/h3-11H,12H2,1-2H3,(H,21,22,25) |
| InChIKey | RVAWWRDQAHRKEW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 182.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|