C21H13N3O9S2 — CID 23852278
[2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 23852278) has the molecular formula C21H13N3O9S2 and a molecular weight of 515.48 g/mol. Its IUPAC name is [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 23852278 |
| Molecular Formula | C21H13N3O9S2 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.01 |
| IUPAC Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)c2ccccc2o1)Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C21H13N3O9S2/c25-15-9-17(33-16-4-2-1-3-14(15)16)20(27)32-11-18(26)23-21-22-10-19(34-21)35(30,31)13-7-5-12(6-8-13)24(28)29/h1-10H,11H2,(H,22,23,26) |
| InChIKey | HGGLIRPNICBNLE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 175.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|