C20H10Cl3N3O7S3 — CID 23989668
[2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate (PubChem CID 23989668) has the molecular formula C20H10Cl3N3O7S3 and a molecular weight of 606.87 g/mol. Its IUPAC name is [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 23989668 |
| Molecular Formula | C20H10Cl3N3O7S3 |
| Molecular Weight | 606.87 g/mol |
| Exact Mass | 604.87 |
| IUPAC Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1sc2cc(Cl)cc(Cl)c2c1Cl)Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C20H10Cl3N3O7S3/c21-9-5-12(22)16-13(6-9)34-18(17(16)23)19(28)33-8-14(27)25-20-24-7-15(35-20)36(31,32)11-3-1-10(2-4-11)26(29)30/h1-7H,8H2,(H,24,25,27) |
| InChIKey | PFSKVDCIPPEEDS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.87 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|