C21H19N3O7S2 — CID 23912574
[2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-propan-2-ylbenzoate (PubChem CID 23912574) has the molecular formula C21H19N3O7S2 and a molecular weight of 489.53 g/mol. Its IUPAC name is [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-propan-2-ylbenzoate.
| Compound Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-propan-2-ylbenzoate |
|---|---|
| PubChem CID | 23912574 |
| Molecular Formula | C21H19N3O7S2 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | [2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-propan-2-ylbenzoate |
| SMILES | CC(C)c1ccc(C(=O)OCC(=O)Nc2ncc(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)s2)cc1 |
| InChI | InChI=1S/C21H19N3O7S2/c1-13(2)14-3-5-15(6-4-14)20(26)31-12-18(25)23-21-22-11-19(32-21)33(29,30)17-9-7-16(8-10-17)24(27)28/h3-11,13H,12H2,1-2H3,(H,22,23,25) |
| InChIKey | FYGXBZRQSWLCLC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|