C19H17N3O7S3 — CID 18573135
3-(4-methylphenyl)sulfonyl-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]propanamide (PubChem CID 18573135) has the molecular formula C19H17N3O7S3 and a molecular weight of 495.56 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(4-methylphenyl)sulfonyl-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 18573135 |
| Molecular Formula | C19H17N3O7S3 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)Nc2ncc(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)s2)cc1 |
| InChI | InChI=1S/C19H17N3O7S3/c1-13-2-6-15(7-3-13)31(26,27)11-10-17(23)21-19-20-12-18(30-19)32(28,29)16-8-4-14(5-9-16)22(24)25/h2-9,12H,10-11H2,1H3,(H,20,21,23) |
| InChIKey | ZCAMCVISPLMNMX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 153.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|