C19H16N4O6S2 — CID 17154535
N-[3-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-3-oxopropyl]benzamide (PubChem CID 17154535) has the molecular formula C19H16N4O6S2 and a molecular weight of 460.49 g/mol. Its IUPAC name is N-[3-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-3-oxopropyl]benzamide.
| Compound Name | N-[3-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 17154535 |
| Molecular Formula | C19H16N4O6S2 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | N-[3-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]-3-oxopropyl]benzamide |
| SMILES | O=C(CCNC(=O)c1ccccc1)Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C19H16N4O6S2/c24-16(10-11-20-18(25)13-4-2-1-3-5-13)22-19-21-12-17(30-19)31(28,29)15-8-6-14(7-9-15)23(26)27/h1-9,12H,10-11H2,(H,20,25)(H,21,22,24) |
| InChIKey | UJAYHWDXPARBLN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 148.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|