C25H18N6O5S3 — CID 2363405
2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide (PubChem CID 2363405) has the molecular formula C25H18N6O5S3 and a molecular weight of 578.66 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 2363405 |
| Molecular Formula | C25H18N6O5S3 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.05 |
| IUPAC Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C25H18N6O5S3/c32-21(27-24-26-15-22(38-24)39(35,36)20-13-11-19(12-14-20)31(33)34)16-37-25-29-28-23(17-7-3-1-4-8-17)30(25)18-9-5-2-6-10-18/h1-15H,16H2,(H,26,27,32) |
| InChIKey | LTEXUWUHGFTTGA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|