C24H21N5O6S3 — CID 177382280
N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]-2-[[6-oxo-4-(3-phenylpropyl)-1H-pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 177382280) has the molecular formula C24H21N5O6S3 and a molecular weight of 571.66 g/mol. Its IUPAC name is N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]-2-[[6-oxo-4-(3-phenylpropyl)-1H-pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]-2-[[6-oxo-4-(3-phenylpropyl)-1H-pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 177382280 |
| Molecular Formula | C24H21N5O6S3 |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.07 |
| IUPAC Name | N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]-2-[[6-oxo-4-(3-phenylpropyl)-1H-pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc(CCCc2ccccc2)cc(=O)[nH]1)Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C24H21N5O6S3/c30-20-13-17(8-4-7-16-5-2-1-3-6-16)26-24(27-20)36-15-21(31)28-23-25-14-22(37-23)38(34,35)19-11-9-18(10-12-19)29(32)33/h1-3,5-6,9-14H,4,7-8,15H2,(H,25,28,31)(H,26,27,30) |
| InChIKey | VPIHWKSRKABTCG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|