C19H11N5O9S2 — CID 23731798
2-(5-nitro-1,3-dioxoisoindol-2-yl)-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide (PubChem CID 23731798) has the molecular formula C19H11N5O9S2 and a molecular weight of 517.46 g/mol. Its IUPAC name is 2-(5-nitro-1,3-dioxoisoindol-2-yl)-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(5-nitro-1,3-dioxoisoindol-2-yl)-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 23731798 |
| Molecular Formula | C19H11N5O9S2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.00 |
| IUPAC Name | 2-(5-nitro-1,3-dioxoisoindol-2-yl)-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C19H11N5O9S2/c25-15(9-22-17(26)13-6-3-11(24(30)31)7-14(13)18(22)27)21-19-20-8-16(34-19)35(32,33)12-4-1-10(2-5-12)23(28)29/h1-8H,9H2,(H,20,21,25) |
| InChIKey | ANSQXWVOEVGTMC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 199.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|