C21H19N3O6S — CID 39752417
[2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-ethoxy-3-nitrobenzoate (PubChem CID 39752417) has the molecular formula C21H19N3O6S and a molecular weight of 441.47 g/mol. Its IUPAC name is [2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-ethoxy-3-nitrobenzoate.
| Compound Name | [2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-ethoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 39752417 |
| Molecular Formula | C21H19N3O6S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | [2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-ethoxy-3-nitrobenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)Nc2nc(-c3ccc(C)cc3)cs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H19N3O6S/c1-3-29-18-9-8-15(10-17(18)24(27)28)20(26)30-11-19(25)23-21-22-16(12-31-21)14-6-4-13(2)5-7-14/h4-10,12H,3,11H2,1-2H3,(H,22,23,25) |
| InChIKey | LHRASDQYMANHKE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|