C22H21N5O5S2 — CID 17113804
N-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17113804) has the molecular formula C22H21N5O5S2 and a molecular weight of 499.57 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17113804 |
| Molecular Formula | C22H21N5O5S2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | COc1ccc(-c2csc(NC(=S)NC(=O)c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C22H21N5O5S2/c1-31-16-5-2-14(3-6-16)17-13-34-22(23-17)25-21(33)24-20(28)15-4-7-18(19(12-15)27(29)30)26-8-10-32-11-9-26/h2-7,12-13H,8-11H2,1H3,(H2,23,24,25,28,33) |
| InChIKey | FDXFFXKQLBURLT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|