C20H21IN4O4S — CID 17336133
N-[(4-iodo-3,5-dimethylphenyl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17336133) has the molecular formula C20H21IN4O4S and a molecular weight of 540.38 g/mol. Its IUPAC name is N-[(4-iodo-3,5-dimethylphenyl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[(4-iodo-3,5-dimethylphenyl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17336133 |
| Molecular Formula | C20H21IN4O4S |
| Molecular Weight | 540.38 g/mol |
| Exact Mass | 540.03 |
| IUPAC Name | N-[(4-iodo-3,5-dimethylphenyl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)cc(C)c1I |
| InChI | InChI=1S/C20H21IN4O4S/c1-12-9-15(10-13(2)18(12)21)22-20(30)23-19(26)14-3-4-16(17(11-14)25(27)28)24-5-7-29-8-6-24/h3-4,9-11H,5-8H2,1-2H3,(H2,22,23,26,30) |
| InChIKey | HQVKCZUWECNRNA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|