C13H18N4O5S — CID 9279383
4-(4-acetylpiperazin-1-yl)-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 9279383) has the molecular formula C13H18N4O5S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9279383 |
| Molecular Formula | C13H18N4O5S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N2CCN(C(C)=O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H18N4O5S/c1-10(18)15-5-7-16(8-6-15)12-4-3-11(23(21,22)14-2)9-13(12)17(19)20/h3-4,9,14H,5-8H2,1-2H3 |
| InChIKey | ASWIWYBAQLKGHQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|